C19H26O4Te — CID 134867598
5-(2,6-ditert-butyltelluropyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 134867598) has the molecular formula C19H26O4Te and a molecular weight of 446.01 g/mol. Its IUPAC name is 5-(2,6-ditert-butyltelluropyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(2,6-ditert-butyltelluropyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134867598 |
| Molecular Formula | C19H26O4Te |
| Molecular Weight | 446.01 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 5-(2,6-ditert-butyltelluropyran-4-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2C=C(C(C)(C)C)[Te]C(C(C)(C)C)=C2)C(=O)O1 |
| InChI | InChI=1S/C19H26O4Te/c1-17(2,3)12-9-11(10-13(24-12)18(4,5)6)14-15(20)22-19(7,8)23-16(14)21/h9-10H,1-8H3 |
| InChIKey | YRBOBNGZNZLZAV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.01 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|