C19H20O8 — CID 90907354
5-[(3E)-7-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hepta-3,5-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 90907354) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is 5-[(3E)-7-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hepta-3,5-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3E)-7-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hepta-3,5-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 90907354 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-[(3E)-7-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)hepta-3,5-dienylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=CC=C/C=C/CC=C2C(=O)OC(C)(C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C19H20O8/c1-18(2)24-14(20)12(15(21)25-18)10-8-6-5-7-9-11-13-16(22)26-19(3,4)27-17(13)23/h5-8,10-11H,9H2,1-4H3/b7-5+,8-6? |
| InChIKey | CRIZBEAFOROUKQ-UOBFQKKOSA-N |
| XLogP | 2.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|