C18H18FeO7 — CID 134888222
carbon monoxide;5-[5-(cyclobutadienyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;iron (PubChem CID 134888222) has the molecular formula C18H18FeO7 and a molecular weight of 402.18 g/mol. Its IUPAC name is carbon monoxide;5-[5-(cyclobutadienyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;iron.
| Compound Name | carbon monoxide;5-[5-(cyclobutadienyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;iron |
|---|---|
| PubChem CID | 134888222 |
| Molecular Formula | C18H18FeO7 |
| Molecular Weight | 402.18 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | carbon monoxide;5-[5-(cyclobutadienyl)pentylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;iron |
| SMILES | CC1(C)OC(=O)C(=CCCCCC2=CC=C2)C(=O)O1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C15H18O4.3CO.Fe/c1-15(2)18-13(16)12(14(17)19-15)10-5-3-4-7-11-8-6-9-11;3*1-2;/h6,8-10H,3-5,7H2,1-2H3;;;; |
| InChIKey | CCJCUHLPUAXSQE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 112.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|