C19H23O8- — CID 59079279
5-[(E)-3-(2,2-diethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-diethyl-6-oxo-1,3-dioxin-4-olate (PubChem CID 59079279) has the molecular formula C19H23O8- and a molecular weight of 379.39 g/mol. Its IUPAC name is 5-[(E)-3-(2,2-diethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-diethyl-6-oxo-1,3-dioxin-4-olate.
| Compound Name | 5-[(E)-3-(2,2-diethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-diethyl-6-oxo-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 59079279 |
| Molecular Formula | C19H23O8- |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 5-[(E)-3-(2,2-diethyl-4,6-dioxo-1,3-dioxan-5-ylidene)prop-1-enyl]-2,2-diethyl-6-oxo-1,3-dioxin-4-olate |
| SMILES | CCC1(CC)OC(=O)C(=C/C=C/C2=C([O-])OC(CC)(CC)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C19H24O8/c1-5-18(6-2)24-14(20)12(15(21)25-18)10-9-11-13-16(22)26-19(7-3,8-4)27-17(13)23/h9-11,20H,5-8H2,1-4H3/p-1/b10-9+ |
| InChIKey | GSDNNNPUXRYJLB-MDZDMXLPSA-M |
| XLogP | 1.75 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|