C17H18O8 — CID 123853347
5-[(E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)pent-3-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 123853347) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 5-[(E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)pent-3-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)pent-3-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 123853347 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 5-[(E)-5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)pent-3-enylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C/C=C/CC=C2C(=O)OC(C)(C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C17H18O8/c1-16(2)22-12(18)10(13(19)23-16)8-6-5-7-9-11-14(20)24-17(3,4)25-15(11)21/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| InChIKey | SJRUPEDKLIEPSJ-AATRIKPKSA-N |
| XLogP | 1.46 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|