C15H21O2S+ — CID 23535082
8a-methyl-7-(thiolan-1-ium-1-yl)-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione (PubChem CID 23535082) has the molecular formula C15H21O2S+ and a molecular weight of 265.40 g/mol. Its IUPAC name is 8a-methyl-7-(thiolan-1-ium-1-yl)-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione.
| Compound Name | 8a-methyl-7-(thiolan-1-ium-1-yl)-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione |
|---|---|
| PubChem CID | 23535082 |
| Molecular Formula | C15H21O2S+ |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 8a-methyl-7-(thiolan-1-ium-1-yl)-3,4,7,8-tetrahydro-2H-naphthalene-1,6-dione |
| SMILES | CC12CC([S+]3CCCC3)C(=O)C=C1CCCC2=O |
| InChI | InChI=1S/C15H21O2S/c1-15-10-13(18-7-2-3-8-18)12(16)9-11(15)5-4-6-14(15)17/h9,13H,2-8,10H2,1H3/q+1 |
| InChIKey | CPPJKIRWGOTYIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|