C8H13NaO2 — CID 173462219
sodium;2,2-dimethylcyclohexane-1,3-dione;hydride (PubChem CID 173462219) has the molecular formula C8H13NaO2 and a molecular weight of 164.18 g/mol. Its IUPAC name is sodium;2,2-dimethylcyclohexane-1,3-dione;hydride.
| Compound Name | sodium;2,2-dimethylcyclohexane-1,3-dione;hydride |
|---|---|
| PubChem CID | 173462219 |
| Molecular Formula | C8H13NaO2 |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | sodium;2,2-dimethylcyclohexane-1,3-dione;hydride |
| SMILES | CC1(C)C(=O)CCCC1=O.[H-].[Na+] |
| InChI | InChI=1S/C8H12O2.Na.H/c1-8(2)6(9)4-3-5-7(8)10;;/h3-5H2,1-2H3;;/q;+1;-1 |
| InChIKey | WOSOCHFVUBWJHV-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|