C10H13O4- — CID 57373667
2-(1-methyl-2,6-dioxocyclohexyl)propanoate (PubChem CID 57373667) has the molecular formula C10H13O4- and a molecular weight of 197.21 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxocyclohexyl)propanoate.
| Compound Name | 2-(1-methyl-2,6-dioxocyclohexyl)propanoate |
|---|---|
| PubChem CID | 57373667 |
| Molecular Formula | C10H13O4- |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(1-methyl-2,6-dioxocyclohexyl)propanoate |
| SMILES | CC(C(=O)[O-])C1(C)C(=O)CCCC1=O |
| InChI | InChI=1S/C10H14O4/c1-6(9(13)14)10(2)7(11)4-3-5-8(10)12/h6H,3-5H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | NRKKKIRVGRZRSA-UHFFFAOYSA-M |
| XLogP | -0.30 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|