C19H18F4N6O2 — CID 23535848
3-[[4-[4-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propan-1-ol (PubChem CID 23535848) has the molecular formula C19H18F4N6O2 and a molecular weight of 438.39 g/mol. Its IUPAC name is 3-[[4-[4-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propan-1-ol.
| Compound Name | 3-[[4-[4-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 23535848 |
| Molecular Formula | C19H18F4N6O2 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-[[4-[4-[3-(1,1,2,2-tetrafluoroethoxy)anilino]-1,3,5-triazin-2-yl]-2-pyridinyl]amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2ncnc(Nc3cccc(OC(F)(F)C(F)F)c3)n2)ccn1 |
| InChI | InChI=1S/C19H18F4N6O2/c20-17(21)19(22,23)31-14-4-1-3-13(10-14)28-18-27-11-26-16(29-18)12-5-7-25-15(9-12)24-6-2-8-30/h1,3-5,7,9-11,17,30H,2,6,8H2,(H,24,25)(H,26,27,28,29) |
| InChIKey | QCCMMKONFQMBCQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 105.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|