C30H27FO8S — CID 23539328
methyl 2-(3-fluoro-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-methylsulfonyloxyphenyl)benzoate (PubChem CID 23539328) has the molecular formula C30H27FO8S and a molecular weight of 566.60 g/mol. Its IUPAC name is methyl 2-(3-fluoro-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-methylsulfonyloxyphenyl)benzoate.
| Compound Name | methyl 2-(3-fluoro-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-methylsulfonyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 23539328 |
| Molecular Formula | C30H27FO8S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | methyl 2-(3-fluoro-4-phenylmethoxyphenyl)-3,6-dimethoxy-5-(4-methylsulfonyloxyphenyl)benzoate |
| SMILES | COC(=O)c1c(OC)c(-c2ccc(OS(C)(=O)=O)cc2)cc(OC)c1-c1ccc(OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C30H27FO8S/c1-35-26-17-23(20-10-13-22(14-11-20)39-40(4,33)34)29(36-2)28(30(32)37-3)27(26)21-12-15-25(24(31)16-21)38-18-19-8-6-5-7-9-19/h5-17H,18H2,1-4H3 |
| InChIKey | NQODRCPSCLKYRW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|