C18H35N5O — CID 23540198
(2R)-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-(piperidin-1-ylamino)propan-1-one (PubChem CID 23540198) has the molecular formula C18H35N5O and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R)-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-(piperidin-1-ylamino)propan-1-one.
| Compound Name | (2R)-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-(piperidin-1-ylamino)propan-1-one |
|---|---|
| PubChem CID | 23540198 |
| Molecular Formula | C18H35N5O |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.28 |
| IUPAC Name | (2R)-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-(piperidin-1-ylamino)propan-1-one |
| SMILES | C[C@@H](NN1CCCCC1)C(=O)N1CCN(C2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H35N5O/c1-16(19-23-8-4-3-5-9-23)18(24)22-14-12-21(13-15-22)17-6-10-20(2)11-7-17/h16-17,19H,3-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | RZVDPCBCLMBWRA-MRXNPFEDSA-N |
| XLogP | 0.60 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |