C16H34N6O2 — CID 159416475
1-(4-hydrazinylpiperidin-1-yl)ethanone;1-[4-[methyl(methylamino)amino]piperidin-1-yl]ethanone (PubChem CID 159416475) has the molecular formula C16H34N6O2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-(4-hydrazinylpiperidin-1-yl)ethanone;1-[4-[methyl(methylamino)amino]piperidin-1-yl]ethanone.
| Compound Name | 1-(4-hydrazinylpiperidin-1-yl)ethanone;1-[4-[methyl(methylamino)amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 159416475 |
| Molecular Formula | C16H34N6O2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 1-(4-hydrazinylpiperidin-1-yl)ethanone;1-[4-[methyl(methylamino)amino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(NN)CC1.CNN(C)C1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H19N3O.C7H15N3O/c1-8(13)12-6-4-9(5-7-12)11(3)10-2;1-6(11)10-4-2-7(9-8)3-5-10/h9-10H,4-7H2,1-3H3;7,9H,2-5,8H2,1H3 |
| InChIKey | LPFLUMSCLGMIDC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|