C20H34O3Si3 — CID 23541393
2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]naphthalen-1-ol (PubChem CID 23541393) has the molecular formula C20H34O3Si3 and a molecular weight of 406.75 g/mol. Its IUPAC name is 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]naphthalen-1-ol.
| Compound Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 23541393 |
| Molecular Formula | C20H34O3Si3 |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propyl]naphthalen-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCc1ccc2ccccc2c1O)O[Si](C)(C)C |
| InChI | InChI=1S/C20H34O3Si3/c1-24(2,3)22-26(7,23-25(4,5)6)16-10-12-18-15-14-17-11-8-9-13-19(17)20(18)21/h8-9,11,13-15,21H,10,12,16H2,1-7H3 |
| InChIKey | YEYBQMCGBGXCPJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|