C17H19O3- — CID 23183419
2-ethyl-5-(1-hydroxynaphthalen-2-yl)pentanoate (PubChem CID 23183419) has the molecular formula C17H19O3- and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-ethyl-5-(1-hydroxynaphthalen-2-yl)pentanoate.
| Compound Name | 2-ethyl-5-(1-hydroxynaphthalen-2-yl)pentanoate |
|---|---|
| PubChem CID | 23183419 |
| Molecular Formula | C17H19O3- |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 2-ethyl-5-(1-hydroxynaphthalen-2-yl)pentanoate |
| SMILES | CCC(CCCc1ccc2ccccc2c1O)C(=O)[O-] |
| InChI | InChI=1S/C17H20O3/c1-2-12(17(19)20)7-5-8-14-11-10-13-6-3-4-9-15(13)16(14)18/h3-4,6,9-12,18H,2,5,7-8H2,1H3,(H,19,20)/p-1 |
| InChIKey | AERARFDXWIHANN-UHFFFAOYSA-M |
| XLogP | 2.64 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |