C13H12F5N5O2 — CID 23545976
2,2,3,3,3-pentafluoropropyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate (PubChem CID 23545976) has the molecular formula C13H12F5N5O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 23545976 |
| Molecular Formula | C13H12F5N5O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCC(F)(F)C(F)(F)F)c1nccc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H12F5N5O2/c1-22(7-10(24)25-8-12(14,15)13(16,17)18)11-19-5-3-9(21-11)23-6-2-4-20-23/h2-6H,7-8H2,1H3 |
| InChIKey | IDNAHCJXNLGPKW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|