C15H13F7N4O3S — CID 23545979
3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 23545979) has the molecular formula C15H13F7N4O3S and a molecular weight of 462.35 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23545979 |
| Molecular Formula | C15H13F7N4O3S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentan-2-yl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | COc1cnn(-c2ccnc(SCC(=O)OC(C)C(F)(F)C(F)(F)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C15H13F7N4O3S/c1-8(13(16,17)14(18,19)15(20,21)22)29-11(27)7-30-12-23-4-3-10(25-12)26-6-9(28-2)5-24-26/h3-6,8H,7H2,1-2H3 |
| InChIKey | JUGLBISOWJTPCP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|