C14H12F7N5O2 — CID 23545982
2,2,3,3,4,4,4-heptafluorobutyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate (PubChem CID 23545982) has the molecular formula C14H12F7N5O2 and a molecular weight of 415.27 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 23545982 |
| Molecular Formula | C14H12F7N5O2 |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[methyl-(4-pyrazol-1-ylpyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)c1nccc(-n2cccn2)n1 |
| InChI | InChI=1S/C14H12F7N5O2/c1-25(11-22-5-3-9(24-11)26-6-2-4-23-26)7-10(27)28-8-12(15,16)13(17,18)14(19,20)21/h2-6H,7-8H2,1H3 |
| InChIKey | CXWWPSRLGUNPMJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|