C14H11F7N4O3S — CID 23545986
2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate (PubChem CID 23545986) has the molecular formula C14H11F7N4O3S and a molecular weight of 448.32 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate.
| Compound Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 23545986 |
| Molecular Formula | C14H11F7N4O3S |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-[4-(4-methoxypyrazol-1-yl)pyrimidin-2-yl]sulfanylacetate |
| SMILES | COc1cnn(-c2ccnc(SCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C14H11F7N4O3S/c1-27-8-4-23-25(5-8)9-2-3-22-11(24-9)29-6-10(26)28-7-12(15,16)13(17,18)14(19,20)21/h2-5H,6-7H2,1H3 |
| InChIKey | CXUROBQEJZAZJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|