C16H18N4O3S — CID 23546139
1-benzylsulfonyl-N'-pyridin-2-ylazetidine-2-carbohydrazide (PubChem CID 23546139) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-benzylsulfonyl-N'-pyridin-2-ylazetidine-2-carbohydrazide.
| Compound Name | 1-benzylsulfonyl-N'-pyridin-2-ylazetidine-2-carbohydrazide |
|---|---|
| PubChem CID | 23546139 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1-benzylsulfonyl-N'-pyridin-2-ylazetidine-2-carbohydrazide |
| SMILES | O=C(NNc1ccccn1)C1CCN1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N4O3S/c21-16(19-18-15-8-4-5-10-17-15)14-9-11-20(14)24(22,23)12-13-6-2-1-3-7-13/h1-8,10,14H,9,11-12H2,(H,17,18)(H,19,21) |
| InChIKey | XSHZVXRHASOTOX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|