C17H28O5 — CID 23550673
5,6-dimethyl-3-[1-(2-methylpropoxy)ethoxycarbonyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 23550673) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is 5,6-dimethyl-3-[1-(2-methylpropoxy)ethoxycarbonyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 5,6-dimethyl-3-[1-(2-methylpropoxy)ethoxycarbonyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 23550673 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 5,6-dimethyl-3-[1-(2-methylpropoxy)ethoxycarbonyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC(C)COC(C)OC(=O)C1C2CC(C(C)C2C)C1C(=O)O |
| InChI | InChI=1S/C17H28O5/c1-8(2)7-21-11(5)22-17(20)15-13-6-12(9(3)10(13)4)14(15)16(18)19/h8-15H,6-7H2,1-5H3,(H,18,19) |
| InChIKey | PHYHNBZHCWGZMR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|