C15H29NS — CID 23552399
5,6-ditert-butyl-3-propyl-2,4-dihydro-1,3-thiazine (PubChem CID 23552399) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is 5,6-ditert-butyl-3-propyl-2,4-dihydro-1,3-thiazine.
| Compound Name | 5,6-ditert-butyl-3-propyl-2,4-dihydro-1,3-thiazine |
|---|---|
| PubChem CID | 23552399 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 5,6-ditert-butyl-3-propyl-2,4-dihydro-1,3-thiazine |
| SMILES | CCCN1CSC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H29NS/c1-8-9-16-10-12(14(2,3)4)13(17-11-16)15(5,6)7/h8-11H2,1-7H3 |
| InChIKey | DLIDYLCPGGFWTH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |