C22H28N2O3 — CID 23553352
ethyl 1-[2-[4-(pyridin-3-ylmethyl)phenoxy]ethyl]piperidine-4-carboxylate (PubChem CID 23553352) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethyl 1-[2-[4-(pyridin-3-ylmethyl)phenoxy]ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-(pyridin-3-ylmethyl)phenoxy]ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 23553352 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethyl 1-[2-[4-(pyridin-3-ylmethyl)phenoxy]ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCOc2ccc(Cc3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C22H28N2O3/c1-2-26-22(25)20-9-12-24(13-10-20)14-15-27-21-7-5-18(6-8-21)16-19-4-3-11-23-17-19/h3-8,11,17,20H,2,9-10,12-16H2,1H3 |
| InChIKey | KGMWHOGXSWDNAD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |