C24H30N2O6 — CID 69342245
ethyl 1-[2-[4-[(3-hydroxyphenyl)methylcarbamoyloxy]phenoxy]ethyl]piperidine-4-carboxylate (PubChem CID 69342245) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is ethyl 1-[2-[4-[(3-hydroxyphenyl)methylcarbamoyloxy]phenoxy]ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[4-[(3-hydroxyphenyl)methylcarbamoyloxy]phenoxy]ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 69342245 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl 1-[2-[4-[(3-hydroxyphenyl)methylcarbamoyloxy]phenoxy]ethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCOc2ccc(OC(=O)NCc3cccc(O)c3)cc2)CC1 |
| InChI | InChI=1S/C24H30N2O6/c1-2-30-23(28)19-10-12-26(13-11-19)14-15-31-21-6-8-22(9-7-21)32-24(29)25-17-18-4-3-5-20(27)16-18/h3-9,16,19,27H,2,10-15,17H2,1H3,(H,25,29) |
| InChIKey | YLADUFVVSLAFQR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |