C20H41NO — CID 23557636
4-methoxy-2,2,6,6-tetramethyl-1-(2-methylnonyl)piperidine (PubChem CID 23557636) has the molecular formula C20H41NO and a molecular weight of 311.55 g/mol. Its IUPAC name is 4-methoxy-2,2,6,6-tetramethyl-1-(2-methylnonyl)piperidine.
| Compound Name | 4-methoxy-2,2,6,6-tetramethyl-1-(2-methylnonyl)piperidine |
|---|---|
| PubChem CID | 23557636 |
| Molecular Formula | C20H41NO |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.32 |
| IUPAC Name | 4-methoxy-2,2,6,6-tetramethyl-1-(2-methylnonyl)piperidine |
| SMILES | CCCCCCCC(C)CN1C(C)(C)CC(OC)CC1(C)C |
| InChI | InChI=1S/C20H41NO/c1-8-9-10-11-12-13-17(2)16-21-19(3,4)14-18(22-7)15-20(21,5)6/h17-18H,8-16H2,1-7H3 |
| InChIKey | POVZPMUWVXIEES-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|