C19H25BrO3 — CID 2355978
[2-(2-bromophenyl)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 2355978) has the molecular formula C19H25BrO3 and a molecular weight of 381.31 g/mol. Its IUPAC name is [2-(2-bromophenyl)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-(2-bromophenyl)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2355978 |
| Molecular Formula | C19H25BrO3 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [2-(2-bromophenyl)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C1CCC(C(=O)OCC(=O)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C19H25BrO3/c1-19(2,3)14-10-8-13(9-11-14)18(22)23-12-17(21)15-6-4-5-7-16(15)20/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | RQOQZKHAODGHHS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |