About 5-isothiocyanato-1,3-thiazol-2-amine
5-isothiocyanato-1,3-thiazol-2-amine (PubChem CID 23560048) has the molecular formula C4H3N3S2
and a molecular weight of 157.22 g/mol. Its IUPAC name is 5-isothiocyanato-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-isothiocyanato-1,3-thiazol-2-amine |
| PubChem CID | 23560048 |
| Molecular Formula | C4H3N3S2 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 156.98 |
| IUPAC Name | 5-isothiocyanato-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(N=C=S)s1 |
| InChI | InChI=1S/C4H3N3S2/c5-4-6-1-3(9-4)7-2-8/h1H,(H2,5,6) |
| InChIKey | YAYOTDMQCSXLJW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-isothiocyanato-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isothiocyanato-1,3-thiazol-2-amine?
The IUPAC name of 5-isothiocyanato-1,3-thiazol-2-amine (CID 23560048) is 5-isothiocyanato-1,3-thiazol-2-amine.
What is the SMILES notation for 5-isothiocyanato-1,3-thiazol-2-amine?
The canonical SMILES for 5-isothiocyanato-1,3-thiazol-2-amine is Nc1ncc(N=C=S)s1.
What is the InChIKey of 5-isothiocyanato-1,3-thiazol-2-amine?
The InChIKey is YAYOTDMQCSXLJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3S2/c5-4-6-1-3(9-4)7-2-8/h1H,(H2,5,6).
What are the key properties of 5-isothiocyanato-1,3-thiazol-2-amine?
5-isothiocyanato-1,3-thiazol-2-amine has a molecular weight of 157.22 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isothiocyanato-1,3-thiazol-2-amine is sourced from PubChem (CID 23560048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).