C18H30O4 — CID 23561046
1,3-dioxolan-4-ylmethyl 5-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate (PubChem CID 23561046) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 1,3-dioxolan-4-ylmethyl 5-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate.
| Compound Name | 1,3-dioxolan-4-ylmethyl 5-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate |
|---|---|
| PubChem CID | 23561046 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1,3-dioxolan-4-ylmethyl 5-(5,6-dimethyl-2-bicyclo[2.2.1]heptanyl)pentanoate |
| SMILES | CC1C2CC(CCCCC(=O)OCC3COCO3)C(C2)C1C |
| InChI | InChI=1S/C18H30O4/c1-12-13(2)17-8-15(12)7-14(17)5-3-4-6-18(19)21-10-16-9-20-11-22-16/h12-17H,3-11H2,1-2H3 |
| InChIKey | ARNSBBMTVFABRZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|