C17H26O6 — CID 604471
diethyl 2-(spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl)propanedioate (PubChem CID 604471) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is diethyl 2-(spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl)propanedioate.
| Compound Name | diethyl 2-(spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 604471 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | diethyl 2-(spiro[1,3-dioxolane-2,6'-bicyclo[2.2.1]heptane]-2'-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(CC1CC2CC1C1(C2)OCCO1)C(=O)OCC |
| InChI | InChI=1S/C17H26O6/c1-3-20-15(18)13(16(19)21-4-2)9-12-7-11-8-14(12)17(10-11)22-5-6-23-17/h11-14H,3-10H2,1-2H3 |
| InChIKey | MGGXZKINAWNBKR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|