C59H50Cl2N2O2 — CID 23561725
3,6-dichloro-2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-2-N,7-N-bis(3-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine (PubChem CID 23561725) has the molecular formula C59H50Cl2N2O2 and a molecular weight of 889.97 g/mol. Its IUPAC name is 3,6-dichloro-2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-2-N,7-N-bis(3-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine.
| Compound Name | 3,6-dichloro-2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-2-N,7-N-bis(3-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 23561725 |
| Molecular Formula | C59H50Cl2N2O2 |
| Molecular Weight | 889.97 g/mol |
| Exact Mass | 888.32 |
| IUPAC Name | 3,6-dichloro-2-N,7-N-bis(9,9-dimethylfluoren-2-yl)-2-N,7-N-bis(3-methoxyphenyl)-9,9-dimethylfluorene-2,7-diamine |
| SMILES | COc1cccc(N(c2ccc3c(c2)C(C)(C)c2ccccc2-3)c2cc3c(cc2Cl)-c2cc(Cl)c(N(c4cccc(OC)c4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc2C3(C)C)c1 |
| InChI | InChI=1S/C59H50Cl2N2O2/c1-57(2)47-21-11-9-19-41(47)43-25-23-37(29-49(43)57)62(35-15-13-17-39(27-35)64-7)55-33-51-45(31-53(55)60)46-32-54(61)56(34-52(46)59(51,5)6)63(36-16-14-18-40(28-36)65-8)38-24-26-44-42-20-10-12-22-48(42)58(3,4)50(44)30-38/h9-34H,1-8H3 |
| InChIKey | QLZBCDUMYHTBDX-UHFFFAOYSA-N |
| XLogP | 16.87 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.97 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |