C10H13NO3 — CID 23568790
(E)-3-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)prop-2-enoic acid (PubChem CID 23568790) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (E)-3-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 23568790 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (E)-3-(1-acetyl-3,6-dihydro-2H-pyridin-5-yl)prop-2-enoic acid |
| SMILES | CC(=O)N1CCC=C(/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C10H13NO3/c1-8(12)11-6-2-3-9(7-11)4-5-10(13)14/h3-5H,2,6-7H2,1H3,(H,13,14)/b5-4+ |
| InChIKey | QKUDGZWEZDXDBQ-SNAWJCMRSA-N |
| XLogP | 0.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|