C23H22N2O5S — CID 23568914
(E)-but-2-enedioic acid;3-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile (PubChem CID 23568914) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile.
| Compound Name | (E)-but-2-enedioic acid;3-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile |
|---|---|
| PubChem CID | 23568914 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile |
| SMILES | CNCC[C@@H](Oc1c(C#N)sc2ccccc12)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H18N2OS.C4H4O4/c1-21-12-11-16(14-7-3-2-4-8-14)22-19-15-9-5-6-10-17(15)23-18(19)13-20;5-3(6)1-2-4(7)8/h2-10,16,21H,11-12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t16-;/m1./s1 |
| InChIKey | MUNBCLQYEMDFJO-RWKFXIDCSA-N |
| XLogP | 4.21 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|