C23H21FN2O5S — CID 87903366
(E)-but-2-enedioic acid;4-fluoro-7-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile (PubChem CID 87903366) has the molecular formula C23H21FN2O5S and a molecular weight of 456.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-fluoro-7-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile.
| Compound Name | (E)-but-2-enedioic acid;4-fluoro-7-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile |
|---|---|
| PubChem CID | 87903366 |
| Molecular Formula | C23H21FN2O5S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (E)-but-2-enedioic acid;4-fluoro-7-[(1R)-3-(methylamino)-1-phenylpropoxy]-1-benzothiophene-2-carbonitrile |
| SMILES | CNCC[C@@H](Oc1ccc(F)c2cc(C#N)sc12)c1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H17FN2OS.C4H4O4/c1-22-10-9-17(13-5-3-2-4-6-13)23-18-8-7-16(20)15-11-14(12-21)24-19(15)18;5-3(6)1-2-4(7)8/h2-8,11,17,22H,9-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t17-;/m1./s1 |
| InChIKey | RKGVLACIUXSIJR-YQXMEYCDSA-N |
| XLogP | 4.35 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|