C22H31N7O3 — CID 23569277
2-[1-[4-[(6-ethoxy-1-oxidopyridin-1-ium-3-yl)methylamino]-8-ethylpyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol (PubChem CID 23569277) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-[1-[4-[(6-ethoxy-1-oxidopyridin-1-ium-3-yl)methylamino]-8-ethylpyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[4-[(6-ethoxy-1-oxidopyridin-1-ium-3-yl)methylamino]-8-ethylpyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 23569277 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 2-[1-[4-[(6-ethoxy-1-oxidopyridin-1-ium-3-yl)methylamino]-8-ethylpyrazolo[1,5-a][1,3,5]triazin-2-yl]piperidin-2-yl]ethanol |
| SMILES | CCOc1ccc(CNc2nc(N3CCCCC3CCO)nc3c(CC)cnn23)c[n+]1[O-] |
| InChI | InChI=1S/C22H31N7O3/c1-3-17-14-24-29-20(17)25-22(27-11-6-5-7-18(27)10-12-30)26-21(29)23-13-16-8-9-19(32-4-2)28(31)15-16/h8-9,14-15,18,30H,3-7,10-13H2,1-2H3,(H,23,25,26) |
| InChIKey | SQPAWGBPQZAOKJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|