C8H11BN4O — CID 23570821
(3,5-diaminoindazol-1-yl)-methylborinic acid (PubChem CID 23570821) has the molecular formula C8H11BN4O and a molecular weight of 190.02 g/mol. Its IUPAC name is (3,5-diaminoindazol-1-yl)-methylborinic acid.
| Compound Name | (3,5-diaminoindazol-1-yl)-methylborinic acid |
|---|---|
| PubChem CID | 23570821 |
| Molecular Formula | C8H11BN4O |
| Molecular Weight | 190.02 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (3,5-diaminoindazol-1-yl)-methylborinic acid |
| SMILES | CB(O)n1nc(N)c2cc(N)ccc21 |
| InChI | InChI=1S/C8H11BN4O/c1-9(14)13-7-3-2-5(10)4-6(7)8(11)12-13/h2-4,14H,10H2,1H3,(H2,11,12) |
| InChIKey | LKISMYPSUCXEEY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.02 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|