C23H24N6O2 — CID 23571019
N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 23571019) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 23571019 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)Nc1n[nH]c2ccc(NC(=O)C(CCN)c3ccccc3)cc12 |
| InChI | InChI=1S/C23H24N6O2/c1-29-13-5-8-20(29)23(31)26-21-18-14-16(9-10-19(18)27-28-21)25-22(30)17(11-12-24)15-6-3-2-4-7-15/h2-10,13-14,17H,11-12,24H2,1H3,(H,25,30)(H2,26,27,28,31) |
| InChIKey | HAUQEXHNFOXBDN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |