C23H23N5O2S — CID 23571029
N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-N-methylthiophene-2-carboxamide (PubChem CID 23571029) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 23571029 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[5-[(4-amino-2-phenylbutanoyl)amino]-1H-indazol-3-yl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cccs1)c1n[nH]c2ccc(NC(=O)C(CCN)c3ccccc3)cc12 |
| InChI | InChI=1S/C23H23N5O2S/c1-28(23(30)20-8-5-13-31-20)21-18-14-16(9-10-19(18)26-27-21)25-22(29)17(11-12-24)15-6-3-2-4-7-15/h2-10,13-14,17H,11-12,24H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | VTMASVUXCROPJX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |