C18H29ClO9 — CID 23572316
2-[4-acetyloxy-6-chloro-1-(3-hydroxypropoxy)-1-oxooctan-2-yl]-3-methylbutanedioic acid (PubChem CID 23572316) has the molecular formula C18H29ClO9 and a molecular weight of 424.87 g/mol. Its IUPAC name is 2-[4-acetyloxy-6-chloro-1-(3-hydroxypropoxy)-1-oxooctan-2-yl]-3-methylbutanedioic acid.
| Compound Name | 2-[4-acetyloxy-6-chloro-1-(3-hydroxypropoxy)-1-oxooctan-2-yl]-3-methylbutanedioic acid |
|---|---|
| PubChem CID | 23572316 |
| Molecular Formula | C18H29ClO9 |
| Molecular Weight | 424.87 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[4-acetyloxy-6-chloro-1-(3-hydroxypropoxy)-1-oxooctan-2-yl]-3-methylbutanedioic acid |
| SMILES | CCC(Cl)CC(CC(C(=O)OCCCO)C(C(=O)O)C(C)C(=O)O)OC(C)=O |
| InChI | InChI=1S/C18H29ClO9/c1-4-12(19)8-13(28-11(3)21)9-14(18(26)27-7-5-6-20)15(17(24)25)10(2)16(22)23/h10,12-15,20H,4-9H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | CWNKTBQHIMVCOZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.87 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|