C18H35NO5 — CID 90262364
1-O-[2-(diethylamino)ethyl] 5-O-(3-hydroxypropyl) 2-ethyl-3,4-dimethylpentanedioate (PubChem CID 90262364) has the molecular formula C18H35NO5 and a molecular weight of 345.48 g/mol. Its IUPAC name is 1-O-[2-(diethylamino)ethyl] 5-O-(3-hydroxypropyl) 2-ethyl-3,4-dimethylpentanedioate.
| Compound Name | 1-O-[2-(diethylamino)ethyl] 5-O-(3-hydroxypropyl) 2-ethyl-3,4-dimethylpentanedioate |
|---|---|
| PubChem CID | 90262364 |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1-O-[2-(diethylamino)ethyl] 5-O-(3-hydroxypropyl) 2-ethyl-3,4-dimethylpentanedioate |
| SMILES | CCC(C(=O)OCCN(CC)CC)C(C)C(C)C(=O)OCCCO |
| InChI | InChI=1S/C18H35NO5/c1-6-16(18(22)24-13-10-19(7-2)8-3)14(4)15(5)17(21)23-12-9-11-20/h14-16,20H,6-13H2,1-5H3 |
| InChIKey | YLNZGVUUOILJEM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|