C23H45NO4 — CID 123766362
1-O-butyl 7-O-[2-(diethylamino)ethyl] 6-ethyl-2,3,4,4-tetramethylheptanedioate (PubChem CID 123766362) has the molecular formula C23H45NO4 and a molecular weight of 399.62 g/mol. Its IUPAC name is 1-O-butyl 7-O-[2-(diethylamino)ethyl] 6-ethyl-2,3,4,4-tetramethylheptanedioate.
| Compound Name | 1-O-butyl 7-O-[2-(diethylamino)ethyl] 6-ethyl-2,3,4,4-tetramethylheptanedioate |
|---|---|
| PubChem CID | 123766362 |
| Molecular Formula | C23H45NO4 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.33 |
| IUPAC Name | 1-O-butyl 7-O-[2-(diethylamino)ethyl] 6-ethyl-2,3,4,4-tetramethylheptanedioate |
| SMILES | CCCCOC(=O)C(C)C(C)C(C)(C)CC(CC)C(=O)OCCN(CC)CC |
| InChI | InChI=1S/C23H45NO4/c1-9-13-15-27-21(25)18(5)19(6)23(7,8)17-20(10-2)22(26)28-16-14-24(11-3)12-4/h18-20H,9-17H2,1-8H3 |
| InChIKey | VGBBGLJIRXEEPH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|