C31H33N5O2 — CID 23585728
[(2R)-2-benzylpiperazin-1-yl]-[1-(3-morpholin-4-ylphenyl)-5-phenylimidazol-4-yl]methanone (PubChem CID 23585728) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is [(2R)-2-benzylpiperazin-1-yl]-[1-(3-morpholin-4-ylphenyl)-5-phenylimidazol-4-yl]methanone.
| Compound Name | [(2R)-2-benzylpiperazin-1-yl]-[1-(3-morpholin-4-ylphenyl)-5-phenylimidazol-4-yl]methanone |
|---|---|
| PubChem CID | 23585728 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(2R)-2-benzylpiperazin-1-yl]-[1-(3-morpholin-4-ylphenyl)-5-phenylimidazol-4-yl]methanone |
| SMILES | O=C(c1ncn(-c2cccc(N3CCOCC3)c2)c1-c1ccccc1)N1CCNC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C31H33N5O2/c37-31(35-15-14-32-22-28(35)20-24-8-3-1-4-9-24)29-30(25-10-5-2-6-11-25)36(23-33-29)27-13-7-12-26(21-27)34-16-18-38-19-17-34/h1-13,21,23,28,32H,14-20,22H2/t28-/m1/s1 |
| InChIKey | JPXBITBDNZSDKE-MUUNZHRXSA-N |
| XLogP | 4.03 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |