C22H13Cl2N3O — CID 2358663
3,4-dichloro-N-[2-(4-cyanophenyl)-3H-isoindol-1-ylidene]benzamide (PubChem CID 2358663) has the molecular formula C22H13Cl2N3O and a molecular weight of 406.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(4-cyanophenyl)-3H-isoindol-1-ylidene]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(4-cyanophenyl)-3H-isoindol-1-ylidene]benzamide |
|---|---|
| PubChem CID | 2358663 |
| Molecular Formula | C22H13Cl2N3O |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 3,4-dichloro-N-[2-(4-cyanophenyl)-3H-isoindol-1-ylidene]benzamide |
| SMILES | N#Cc1ccc(N2Cc3ccccc3/C2=N\C(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H13Cl2N3O/c23-19-10-7-15(11-20(19)24)22(28)26-21-18-4-2-1-3-16(18)13-27(21)17-8-5-14(12-25)6-9-17/h1-11H,13H2/b26-21+ |
| InChIKey | XFSQPXVGHSTGBW-YYADALCUSA-N |
| XLogP | 5.47 |
| TPSA | 56.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|