C20H14ClN3O — CID 2333062
N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide (PubChem CID 2333062) has the molecular formula C20H14ClN3O and a molecular weight of 347.81 g/mol. Its IUPAC name is N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide.
| Compound Name | N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
|---|---|
| PubChem CID | 2333062 |
| Molecular Formula | C20H14ClN3O |
| Molecular Weight | 347.81 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)benzamide |
| SMILES | O=C(/N=C1\N=C2C=CC(Cl)=CN2Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H14ClN3O/c21-16-10-11-18-22-19(23-20(25)14-6-2-1-3-7-14)17-9-5-4-8-15(17)12-24(18)13-16/h1-11,13H,12H2/b23-19- |
| InChIKey | XGHJMUNQNCCKAE-NMWGTECJSA-N |
| XLogP | 4.14 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|