C15H11Cl2N3O — CID 2317591
2,2-dichloro-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)acetamide (PubChem CID 2317591) has the molecular formula C15H11Cl2N3O and a molecular weight of 320.18 g/mol. Its IUPAC name is 2,2-dichloro-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)acetamide.
| Compound Name | 2,2-dichloro-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)acetamide |
|---|---|
| PubChem CID | 2317591 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2,2-dichloro-N-(11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)acetamide |
| SMILES | O=C(/N=C1\N=C2C=CC=CN2Cc2ccccc21)C(Cl)Cl |
| InChI | InChI=1S/C15H11Cl2N3O/c16-13(17)15(21)19-14-11-6-2-1-5-10(11)9-20-8-4-3-7-12(20)18-14/h1-8,13H,9H2/b19-14- |
| InChIKey | ZNCZRFMTQVJFJX-RGEXLXHISA-N |
| XLogP | 3.06 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|