C16H16N4O — CID 2314892
2-methyl-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)propanamide (PubChem CID 2314892) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-methyl-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)propanamide.
| Compound Name | 2-methyl-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)propanamide |
|---|---|
| PubChem CID | 2314892 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-methyl-N-(11H-pyrimido[1,2-b][2,4]benzodiazepin-6-ylidene)propanamide |
| SMILES | CC(C)C(=O)/N=C1\N=C2N=CC=CN2Cc2ccccc21 |
| InChI | InChI=1S/C16H16N4O/c1-11(2)15(21)18-14-13-7-4-3-6-12(13)10-20-9-5-8-17-16(20)19-14/h3-9,11H,10H2,1-2H3/b18-14- |
| InChIKey | SBGZUVKKGXRPNY-JXAWBTAJSA-N |
| XLogP | 2.39 |
| TPSA | 57.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|