C25H23ClN4O3S — CID 4077898
N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 4077898) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4077898 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-(2-chloro-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(/N=C1\N=C2C=CC(Cl)=CN2Cc2ccccc21)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H23ClN4O3S/c26-20-10-13-23-27-24(22-7-3-2-6-19(22)16-29(23)17-20)28-25(31)18-8-11-21(12-9-18)34(32,33)30-14-4-1-5-15-30/h2-3,6-13,17H,1,4-5,14-16H2/b28-24- |
| InChIKey | AEFDKHFSZLMNIY-COOPMVRXSA-N |
| XLogP | 4.31 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|