C10H14N2O2 — CID 23587962
N-(1,5,6-trimethyl-2-oxo-3-pyridinyl)acetamide (PubChem CID 23587962) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N-(1,5,6-trimethyl-2-oxo-3-pyridinyl)acetamide.
| Compound Name | N-(1,5,6-trimethyl-2-oxo-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 23587962 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N-(1,5,6-trimethyl-2-oxo-3-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1cc(C)c(C)n(C)c1=O |
| InChI | InChI=1S/C10H14N2O2/c1-6-5-9(11-8(3)13)10(14)12(4)7(6)2/h5H,1-4H3,(H,11,13) |
| InChIKey | OKLKERUCMFXCLM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |