C17H26N4O15P3S-3 — CID 23589077
[[[5-[5-[(E)-3-[(1-amino-5-sulfanylpentylidene)amino]prop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 23589077) has the molecular formula C17H26N4O15P3S-3 and a molecular weight of 651.40 g/mol. Its IUPAC name is [[[5-[5-[(E)-3-[(1-amino-5-sulfanylpentylidene)amino]prop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[5-[5-[(E)-3-[(1-amino-5-sulfanylpentylidene)amino]prop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 23589077 |
| Molecular Formula | C17H26N4O15P3S-3 |
| Molecular Weight | 651.40 g/mol |
| Exact Mass | 651.03 |
| IUPAC Name | [[[5-[5-[(E)-3-[(1-amino-5-sulfanylpentylidene)amino]prop-1-enyl]-2,4-dioxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | N/C(CCCCS)=N/C/C=C/c1cn(C2OC(COP(=O)(O)OP(=O)([O-])OP(=O)([O-])[O-])C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N4O15P3S/c18-12(5-1-2-7-40)19-6-3-4-10-8-21(17(25)20-15(10)24)16-14(23)13(22)11(34-16)9-33-38(29,30)36-39(31,32)35-37(26,27)28/h3-4,8,11,13-14,16,22-23,40H,1-2,5-7,9H2,(H2,18,19)(H,29,30)(H,31,32)(H,20,24,25)(H2,26,27,28)/p-3/b4-3+ |
| InChIKey | RHFYNHIDPMCSPD-ONEGZZNKSA-K |
| XLogP | -2.93 |
| TPSA | 311.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.40 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|