C11H11F3NO7S2- — CID 23591346
2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate (PubChem CID 23591346) has the molecular formula C11H11F3NO7S2- and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate.
| Compound Name | 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate |
|---|---|
| PubChem CID | 23591346 |
| Molecular Formula | C11H11F3NO7S2- |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 2-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]ethanesulfonate |
| SMILES | CS(=O)(=O)O/N=C(/c1ccc(OCCS(=O)(=O)[O-])cc1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO7S2/c1-23(16,17)22-15-10(11(12,13)14)8-2-4-9(5-3-8)21-6-7-24(18,19)20/h2-5H,6-7H2,1H3,(H,18,19,20)/p-1/b15-10- |
| InChIKey | FKSYLDATZJJEGO-GDNBJRDFSA-M |
| XLogP | 0.85 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|