C13H24O2 — CID 23591510
(E)-9-ethenylundec-5-ene-1,11-diol (PubChem CID 23591510) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (E)-9-ethenylundec-5-ene-1,11-diol.
| Compound Name | (E)-9-ethenylundec-5-ene-1,11-diol |
|---|---|
| PubChem CID | 23591510 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (E)-9-ethenylundec-5-ene-1,11-diol |
| SMILES | C=CC(CCO)CC/C=C/CCCCO |
| InChI | InChI=1S/C13H24O2/c1-2-13(10-12-15)9-7-5-3-4-6-8-11-14/h2-3,5,13-15H,1,4,6-12H2/b5-3+ |
| InChIKey | QACUCUYGNZFWFO-HWKANZROSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|