C19H48O2 — CID 160519828
(2E,8Z)-5-ethenyldeca-2,8-diene-1,10-diol;methane (PubChem CID 160519828) has the molecular formula C19H48O2 and a molecular weight of 308.59 g/mol. Its IUPAC name is (2E,8Z)-5-ethenyldeca-2,8-diene-1,10-diol;methane.
| Compound Name | (2E,8Z)-5-ethenyldeca-2,8-diene-1,10-diol;methane |
|---|---|
| PubChem CID | 160519828 |
| Molecular Formula | C19H48O2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.37 |
| IUPAC Name | (2E,8Z)-5-ethenyldeca-2,8-diene-1,10-diol;methane |
| SMILES | C.C.C.C.C.C.C.C=CC(C/C=C/CO)CC/C=C\CO |
| InChI | InChI=1S/C12H20O2.7CH4/c1-2-12(9-5-7-11-14)8-4-3-6-10-13;;;;;;;/h2-3,5-7,12-14H,1,4,8-11H2;7*1H4/b6-3-,7-5+;;;;;;; |
| InChIKey | QUCYPZOUWNADNB-RKNQVPHASA-N |
| XLogP | 6.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|